C25H23N3O5S2 — CID 19252253
2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 19252253) has the molecular formula C25H23N3O5S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19252253 |
| Molecular Formula | C25H23N3O5S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 2-[(1S,9S)-8,8-dimethyl-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | Cc1ccc(N2C(=O)[C@H]3Sc4c(sc(=O)n4CC(=O)Nc4ccc(O)cc4)C(C)(C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O5S2/c1-13-4-8-15(9-5-13)28-21(31)18-19(22(28)32)34-23-20(25(18,2)3)35-24(33)27(23)12-17(30)26-14-6-10-16(29)11-7-14/h4-11,18-19,29H,12H2,1-3H3,(H,26,30)/t18-,19+/m1/s1 |
| InChIKey | KHESACHFBILROT-MOPGFXCFSA-N |
| XLogP | 3.50 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|