C27H25N3O6S2 — CID 19252296
ethyl 4-[(1S,9S)-4-(2-anilino-2-oxoethyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19252296) has the molecular formula C27H25N3O6S2 and a molecular weight of 551.65 g/mol. Its IUPAC name is ethyl 4-[(1S,9S)-4-(2-anilino-2-oxoethyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1S,9S)-4-(2-anilino-2-oxoethyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19252296 |
| Molecular Formula | C27H25N3O6S2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | ethyl 4-[(1S,9S)-4-(2-anilino-2-oxoethyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3Sc4c(sc(=O)n4CC(=O)Nc4ccccc4)C(C)(C)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C27H25N3O6S2/c1-4-36-25(34)15-10-12-17(13-11-15)30-22(32)19-20(23(30)33)37-24-21(27(19,2)3)38-26(35)29(24)14-18(31)28-16-8-6-5-7-9-16/h5-13,19-20H,4,14H2,1-3H3,(H,28,31)/t19-,20+/m1/s1 |
| InChIKey | ISEHDENOQDZHPI-UXHICEINSA-N |
| XLogP | 3.67 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|