C20H20N2O5S2 — CID 16636888
ethyl 2-(8,8-dimethyl-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetate (PubChem CID 16636888) has the molecular formula C20H20N2O5S2 and a molecular weight of 432.52 g/mol. Its IUPAC name is ethyl 2-(8,8-dimethyl-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetate.
| Compound Name | ethyl 2-(8,8-dimethyl-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetate |
|---|---|
| PubChem CID | 16636888 |
| Molecular Formula | C20H20N2O5S2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | ethyl 2-(8,8-dimethyl-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl)acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)C(C)(C)C1C(=O)N(c3ccccc3)C(=O)C1S2 |
| InChI | InChI=1S/C20H20N2O5S2/c1-4-27-12(23)10-21-18-15(29-19(21)26)20(2,3)13-14(28-18)17(25)22(16(13)24)11-8-6-5-7-9-11/h5-9,13-14H,4,10H2,1-3H3 |
| InChIKey | AJBKBEKOQGITNB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|