C24H19Cl2N3O4S2 — CID 16636803
N-(4-chlorophenyl)-2-[11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 16636803) has the molecular formula C24H19Cl2N3O4S2 and a molecular weight of 548.47 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 16636803 |
| Molecular Formula | C24H19Cl2N3O4S2 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 547.02 |
| IUPAC Name | N-(4-chlorophenyl)-2-[11-(4-chlorophenyl)-8,8-dimethyl-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | CC1(C)c2sc(=O)n(CC(=O)Nc3ccc(Cl)cc3)c2SC2C(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C24H19Cl2N3O4S2/c1-24(2)17-18(21(32)29(20(17)31)15-9-5-13(26)6-10-15)34-22-19(24)35-23(33)28(22)11-16(30)27-14-7-3-12(25)4-8-14/h3-10,17-18H,11H2,1-2H3,(H,27,30) |
| InChIKey | KACMFSSRUTUZDX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|