C25H20F3N3O5S2 — CID 19252397
2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 19252397) has the molecular formula C25H20F3N3O5S2 and a molecular weight of 563.58 g/mol. Its IUPAC name is 2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19252397 |
| Molecular Formula | C25H20F3N3O5S2 |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 2-[(1S,9S)-8,8-dimethyl-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CC1(C)c2sc(=O)n(CC(=O)Nc3ccc(O)cc3)c2S[C@@H]2C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@@H]21 |
| InChI | InChI=1S/C25H20F3N3O5S2/c1-24(2)17-18(21(35)31(20(17)34)15-6-4-3-5-14(15)25(26,27)28)37-22-19(24)38-23(36)30(22)11-16(33)29-12-7-9-13(32)10-8-12/h3-10,17-18,32H,11H2,1-2H3,(H,29,33)/t17-,18+/m1/s1 |
| InChIKey | WKJBYHHTGSEAMP-MSOLQXFVSA-N |
| XLogP | 4.21 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|