C9H5N5O3S — CID 19332769
5-(4-nitro-1H-pyrazol-5-yl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 19332769) has the molecular formula C9H5N5O3S and a molecular weight of 263.24 g/mol. Its IUPAC name is 5-(4-nitro-1H-pyrazol-5-yl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4-nitro-1H-pyrazol-5-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19332769 |
| Molecular Formula | C9H5N5O3S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 5-(4-nitro-1H-pyrazol-5-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cn[nH]c1-c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C9H5N5O3S/c15-14(16)5-4-10-12-7(5)9-11-8(13-17-9)6-2-1-3-18-6/h1-4H,(H,10,12) |
| InChIKey | QVLVRFJRDRMLFG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|