C24H43N3O5 — CID 19357394
3,4-dimethyl-2,6-dinitrophenolate;tetrabutylazanium (PubChem CID 19357394) has the molecular formula C24H43N3O5 and a molecular weight of 453.62 g/mol. Its IUPAC name is 3,4-dimethyl-2,6-dinitrophenolate;tetrabutylazanium.
| Compound Name | 3,4-dimethyl-2,6-dinitrophenolate;tetrabutylazanium |
|---|---|
| PubChem CID | 19357394 |
| Molecular Formula | C24H43N3O5 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 3,4-dimethyl-2,6-dinitrophenolate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Cc1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H36N.C8H8N2O5/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-4-3-6(9(12)13)8(11)7(5(4)2)10(14)15/h5-16H2,1-4H3;3,11H,1-2H3/q+1;/p-1 |
| InChIKey | UDIKAEALJJNELH-UHFFFAOYSA-M |
| XLogP | 6.20 |
| TPSA | 109.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|