C20H21NO6S — CID 19375717
6-[3-(4-methoxyoxan-4-yl)phenyl]sulfonyl-3-methyl-1,3-benzoxazol-2-one (PubChem CID 19375717) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is 6-[3-(4-methoxyoxan-4-yl)phenyl]sulfonyl-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[3-(4-methoxyoxan-4-yl)phenyl]sulfonyl-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 19375717 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 6-[3-(4-methoxyoxan-4-yl)phenyl]sulfonyl-3-methyl-1,3-benzoxazol-2-one |
| SMILES | COC1(c2cccc(S(=O)(=O)c3ccc4c(c3)oc(=O)n4C)c2)CCOCC1 |
| InChI | InChI=1S/C20H21NO6S/c1-21-17-7-6-16(13-18(17)27-19(21)22)28(23,24)15-5-3-4-14(12-15)20(25-2)8-10-26-11-9-20/h3-7,12-13H,8-11H2,1-2H3 |
| InChIKey | JCAAOMVWPZIJHP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |