C14H12Cl2O11V — CID 19382546
bis(3-acetyl-3-chloro-2,4-dioxopentanoate);oxovanadium(2+) (PubChem CID 19382546) has the molecular formula C14H12Cl2O11V and a molecular weight of 478.09 g/mol. Its IUPAC name is bis(3-acetyl-3-chloro-2,4-dioxopentanoate);oxovanadium(2+).
| Compound Name | bis(3-acetyl-3-chloro-2,4-dioxopentanoate);oxovanadium(2+) |
|---|---|
| PubChem CID | 19382546 |
| Molecular Formula | C14H12Cl2O11V |
| Molecular Weight | 478.09 g/mol |
| Exact Mass | 476.92 |
| IUPAC Name | bis(3-acetyl-3-chloro-2,4-dioxopentanoate);oxovanadium(2+) |
| SMILES | CC(=O)C(Cl)(C(C)=O)C(=O)C(=O)[O-].CC(=O)C(Cl)(C(C)=O)C(=O)C(=O)[O-].O=[V+2] |
| InChI | InChI=1S/2C7H7ClO5.O.V/c2*1-3(9)7(8,4(2)10)5(11)6(12)13;;/h2*1-2H3,(H,12,13);;/q;;;+2/p-2 |
| InChIKey | SLYFBDIAMFTBCA-UHFFFAOYSA-L |
| XLogP | -3.20 |
| TPSA | 199.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.09 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|