C25H28N4O7S — CID 19386794
(4-nitrophenyl)methyl 2-[[[4,5-bis(prop-2-enoxy)pyridine-2-carbonyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 19386794) has the molecular formula C25H28N4O7S and a molecular weight of 528.59 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[[[4,5-bis(prop-2-enoxy)pyridine-2-carbonyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 2-[[[4,5-bis(prop-2-enoxy)pyridine-2-carbonyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 19386794 |
| Molecular Formula | C25H28N4O7S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[[[4,5-bis(prop-2-enoxy)pyridine-2-carbonyl]amino]methyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOc1cnc(C(=O)NCC2CC(S)CN2C(=O)OCc2ccc([N+](=O)[O-])cc2)cc1OCC=C |
| InChI | InChI=1S/C25H28N4O7S/c1-3-9-34-22-12-21(26-14-23(22)35-10-4-2)24(30)27-13-19-11-20(37)15-28(19)25(31)36-16-17-5-7-18(8-6-17)29(32)33/h3-8,12,14,19-20,37H,1-2,9-11,13,15-16H2,(H,27,30) |
| InChIKey | NVTXRAWHFJCEPS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|