C25H27FN2O — CID 19435162
3-(9-fluoro-6-methyl-2-prop-2-enyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl)phenol (PubChem CID 19435162) has the molecular formula C25H27FN2O and a molecular weight of 390.50 g/mol. Its IUPAC name is 3-(9-fluoro-6-methyl-2-prop-2-enyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl)phenol.
| Compound Name | 3-(9-fluoro-6-methyl-2-prop-2-enyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl)phenol |
|---|---|
| PubChem CID | 19435162 |
| Molecular Formula | C25H27FN2O |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-(9-fluoro-6-methyl-2-prop-2-enyl-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazol-4a-yl)phenol |
| SMILES | C=CCN1CCC2(c3cccc(O)c3)Cc3c(c4cc(F)ccc4n3C)CC2C1 |
| InChI | InChI=1S/C25H27FN2O/c1-3-10-28-11-9-25(17-5-4-6-20(29)12-17)15-24-21(13-18(25)16-28)22-14-19(26)7-8-23(22)27(24)2/h3-8,12,14,18,29H,1,9-11,13,15-16H2,2H3 |
| InChIKey | CMSSNEMLEXPYMX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|