About 2-nitrosothiophene;pyrrolidine-2-carboxylic acid
2-nitrosothiophene;pyrrolidine-2-carboxylic acid (PubChem CID 19436882) has the molecular formula C9H12N2O3S
and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-nitrosothiophene;pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | 2-nitrosothiophene;pyrrolidine-2-carboxylic acid |
| PubChem CID | 19436882 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-nitrosothiophene;pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1.O=Nc1cccs1 |
| InChI | InChI=1S/C5H9NO2.C4H3NOS/c7-5(8)4-2-1-3-6-4;6-5-4-2-1-3-7-4/h4,6H,1-3H2,(H,7,8);1-3H |
| InChIKey | QXGPMHCLQDQTNW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-nitrosothiophene;pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosothiophene;pyrrolidine-2-carboxylic acid?
The IUPAC name of 2-nitrosothiophene;pyrrolidine-2-carboxylic acid (CID 19436882) is 2-nitrosothiophene;pyrrolidine-2-carboxylic acid.
What is the SMILES notation for 2-nitrosothiophene;pyrrolidine-2-carboxylic acid?
The canonical SMILES for 2-nitrosothiophene;pyrrolidine-2-carboxylic acid is O=C(O)C1CCCN1.O=Nc1cccs1.
What is the InChIKey of 2-nitrosothiophene;pyrrolidine-2-carboxylic acid?
The InChIKey is QXGPMHCLQDQTNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C4H3NOS/c7-5(8)4-2-1-3-6-4;6-5-4-2-1-3-7-4/h4,6H,1-3H2,(H,7,8);1-3H.
What are the key properties of 2-nitrosothiophene;pyrrolidine-2-carboxylic acid?
2-nitrosothiophene;pyrrolidine-2-carboxylic acid has a molecular weight of 228.27 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosothiophene;pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 19436882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).