C17H19F2N3O2 — CID 19449930
(Z)-3-[4-(difluoromethoxy)phenyl]-N-[(1-ethylpyrazol-3-yl)methyl]-N-methylprop-2-enamide (PubChem CID 19449930) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is (Z)-3-[4-(difluoromethoxy)phenyl]-N-[(1-ethylpyrazol-3-yl)methyl]-N-methylprop-2-enamide.
| Compound Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[(1-ethylpyrazol-3-yl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 19449930 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (Z)-3-[4-(difluoromethoxy)phenyl]-N-[(1-ethylpyrazol-3-yl)methyl]-N-methylprop-2-enamide |
| SMILES | CCn1ccc(CN(C)C(=O)/C=C\c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C17H19F2N3O2/c1-3-22-11-10-14(20-22)12-21(2)16(23)9-6-13-4-7-15(8-5-13)24-17(18)19/h4-11,17H,3,12H2,1-2H3/b9-6- |
| InChIKey | PXAVGEQNARZREY-TWGQIWQCSA-N |
| XLogP | 3.18 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|