C22H14Cl2N2O7S — CID 19459652
methyl 3-chloro-6-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 19459652) has the molecular formula C22H14Cl2N2O7S and a molecular weight of 521.33 g/mol. Its IUPAC name is methyl 3-chloro-6-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19459652 |
| Molecular Formula | C22H14Cl2N2O7S |
| Molecular Weight | 521.33 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | methyl 3-chloro-6-[[5-[(2-chloro-5-nitrophenoxy)methyl]furan-2-carbonyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=O)c3ccc(COc4cc([N+](=O)[O-])ccc4Cl)o3)ccc2c1Cl |
| InChI | InChI=1S/C22H14Cl2N2O7S/c1-31-22(28)20-19(24)14-5-2-11(8-18(14)34-20)25-21(27)16-7-4-13(33-16)10-32-17-9-12(26(29)30)3-6-15(17)23/h2-9H,10H2,1H3,(H,25,27) |
| InChIKey | JVEQZRUJEAGSKN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.33 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|