C27H20Cl2N4O5S — CID 19616170
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-(3-quinoxalin-2-ylphenyl)butanamide (PubChem CID 19616170) has the molecular formula C27H20Cl2N4O5S and a molecular weight of 583.45 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-(3-quinoxalin-2-ylphenyl)butanamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-(3-quinoxalin-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 19616170 |
| Molecular Formula | C27H20Cl2N4O5S |
| Molecular Weight | 583.45 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-4-methylsulfonyl-N-(3-quinoxalin-2-ylphenyl)butanamide |
| SMILES | CS(=O)(=O)CCC(C(=O)Nc1cccc(-c2cnc3ccccc3n2)c1)N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C27H20Cl2N4O5S/c1-39(37,38)10-9-24(33-26(35)17-12-19(28)20(29)13-18(17)27(33)36)25(34)31-16-6-4-5-15(11-16)23-14-30-21-7-2-3-8-22(21)32-23/h2-8,11-14,24H,9-10H2,1H3,(H,31,34) |
| InChIKey | ZRKUULQCWCNHDU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|