C7H6F3N3O4 — CID 19622812
5-methyl-4-nitro-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid (PubChem CID 19622812) has the molecular formula C7H6F3N3O4 and a molecular weight of 253.14 g/mol. Its IUPAC name is 5-methyl-4-nitro-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-methyl-4-nitro-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19622812 |
| Molecular Formula | C7H6F3N3O4 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 5-methyl-4-nitro-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid |
| SMILES | Cc1c([N+](=O)[O-])c(C(=O)O)nn1CC(F)(F)F |
| InChI | InChI=1S/C7H6F3N3O4/c1-3-5(13(16)17)4(6(14)15)11-12(3)2-7(8,9)10/h2H2,1H3,(H,14,15) |
| InChIKey | MTSLYGXFDDKWNE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|