C19H32N2O2S — CID 19651784
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylhexyl)thiourea (PubChem CID 19651784) has the molecular formula C19H32N2O2S and a molecular weight of 352.54 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylhexyl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylhexyl)thiourea |
|---|---|
| PubChem CID | 19651784 |
| Molecular Formula | C19H32N2O2S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-ethylhexyl)thiourea |
| SMILES | CCCCC(CC)CNC(=S)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H32N2O2S/c1-5-7-8-15(6-2)14-21-19(24)20-12-11-16-9-10-17(22-3)18(13-16)23-4/h9-10,13,15H,5-8,11-12,14H2,1-4H3,(H2,20,21,24) |
| InChIKey | WRWZVCTYLOATIB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|