C20H29NO4S — CID 19681579
N-[1-(1-adamantyl)ethyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 19681579) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 19681579 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C20H29NO4S/c1-13(20-10-14-6-15(11-20)8-16(7-14)12-20)21-26(22,23)19-5-4-17(24-2)9-18(19)25-3/h4-5,9,13-16,21H,6-8,10-12H2,1-3H3 |
| InChIKey | OFVMMZNEGJNYCI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |