C13H31NO6P2 — CID 19699981
4,4-bis(diethoxyphosphoryl)-N-methylbutan-1-amine (PubChem CID 19699981) has the molecular formula C13H31NO6P2 and a molecular weight of 359.34 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)-N-methylbutan-1-amine.
| Compound Name | 4,4-bis(diethoxyphosphoryl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 19699981 |
| Molecular Formula | C13H31NO6P2 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)-N-methylbutan-1-amine |
| SMILES | CCOP(=O)(OCC)C(CCCNC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H31NO6P2/c1-6-17-21(15,18-7-2)13(11-10-12-14-5)22(16,19-8-3)20-9-4/h13-14H,6-12H2,1-5H3 |
| InChIKey | BBPYUBRJHYBLCF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|