C23H24NO7PS — CID 19705723
4-[4-(N-benzoylanilino)phenyl]-1-phosphonobutane-1-sulfonic acid (PubChem CID 19705723) has the molecular formula C23H24NO7PS and a molecular weight of 489.49 g/mol. Its IUPAC name is 4-[4-(N-benzoylanilino)phenyl]-1-phosphonobutane-1-sulfonic acid.
| Compound Name | 4-[4-(N-benzoylanilino)phenyl]-1-phosphonobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 19705723 |
| Molecular Formula | C23H24NO7PS |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 4-[4-(N-benzoylanilino)phenyl]-1-phosphonobutane-1-sulfonic acid |
| SMILES | O=C(c1ccccc1)N(c1ccccc1)c1ccc(CCCC(P(=O)(O)O)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C23H24NO7PS/c25-23(19-9-3-1-4-10-19)24(20-11-5-2-6-12-20)21-16-14-18(15-17-21)8-7-13-22(32(26,27)28)33(29,30)31/h1-6,9-12,14-17,22H,7-8,13H2,(H2,26,27,28)(H,29,30,31) |
| InChIKey | WOJUZCMMGCEFEM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|