C24H21ClN2O2 — CID 19715573
(4-chlorophenyl)methanamine;2-(3-methylphenyl)quinoline-4-carboxylic acid (PubChem CID 19715573) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is (4-chlorophenyl)methanamine;2-(3-methylphenyl)quinoline-4-carboxylic acid.
| Compound Name | (4-chlorophenyl)methanamine;2-(3-methylphenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 19715573 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (4-chlorophenyl)methanamine;2-(3-methylphenyl)quinoline-4-carboxylic acid |
| SMILES | Cc1cccc(-c2cc(C(=O)O)c3ccccc3n2)c1.NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13NO2.C7H8ClN/c1-11-5-4-6-12(9-11)16-10-14(17(19)20)13-7-2-3-8-15(13)18-16;8-7-3-1-6(5-9)2-4-7/h2-10H,1H3,(H,19,20);1-4H,5,9H2 |
| InChIKey | BVYUGHZLGUNXPD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |