C21H23NO5 — CID 19769882
N-hydroxy-N-[1-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethyl]acetamide (PubChem CID 19769882) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is N-hydroxy-N-[1-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethyl]acetamide.
| Compound Name | N-hydroxy-N-[1-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 19769882 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-hydroxy-N-[1-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethyl]acetamide |
| SMILES | COc1cc(C#Cc2cccc(C(C)N(O)C(C)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H23NO5/c1-14(22(24)15(2)23)18-8-6-7-16(11-18)9-10-17-12-19(25-3)21(27-5)20(13-17)26-4/h6-8,11-14,24H,1-5H3 |
| InChIKey | KPFJODZKZYEDOX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|