C24H25ClN2O2S2 — CID 19780288
(E)-3-[3-[(2-chlorophenyl)methyl]-2-cyclohexylsulfanylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid (PubChem CID 19780288) has the molecular formula C24H25ClN2O2S2 and a molecular weight of 473.06 g/mol. Its IUPAC name is (E)-3-[3-[(2-chlorophenyl)methyl]-2-cyclohexylsulfanylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(2-chlorophenyl)methyl]-2-cyclohexylsulfanylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 19780288 |
| Molecular Formula | C24H25ClN2O2S2 |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (E)-3-[3-[(2-chlorophenyl)methyl]-2-cyclohexylsulfanylimidazol-4-yl]-2-(thiophen-2-ylmethyl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1cnc(SC2CCCCC2)n1Cc1ccccc1Cl)Cc1cccs1 |
| InChI | InChI=1S/C24H25ClN2O2S2/c25-22-11-5-4-7-17(22)16-27-19(13-18(23(28)29)14-21-10-6-12-30-21)15-26-24(27)31-20-8-2-1-3-9-20/h4-7,10-13,15,20H,1-3,8-9,14,16H2,(H,28,29)/b18-13+ |
| InChIKey | AJTXGGOCCNEPCL-QGOAFFKASA-N |
| XLogP | 6.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|