C21H20FNO — CID 19818488
4-(4-fluorophenyl)-1-methyl-5-phenyl-2-propan-2-ylpyrrole-3-carbaldehyde (PubChem CID 19818488) has the molecular formula C21H20FNO and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-methyl-5-phenyl-2-propan-2-ylpyrrole-3-carbaldehyde.
| Compound Name | 4-(4-fluorophenyl)-1-methyl-5-phenyl-2-propan-2-ylpyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 19818488 |
| Molecular Formula | C21H20FNO |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-(4-fluorophenyl)-1-methyl-5-phenyl-2-propan-2-ylpyrrole-3-carbaldehyde |
| SMILES | CC(C)c1c(C=O)c(-c2ccc(F)cc2)c(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H20FNO/c1-14(2)20-18(13-24)19(15-9-11-17(22)12-10-15)21(23(20)3)16-7-5-4-6-8-16/h4-14H,1-3H3 |
| InChIKey | UQEVZJWRGONDIM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|