C16H14F4O2 — CID 19871683
2-methyl-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]but-3-yn-2-ol (PubChem CID 19871683) has the molecular formula C16H14F4O2 and a molecular weight of 314.28 g/mol. Its IUPAC name is 2-methyl-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]but-3-yn-2-ol.
| Compound Name | 2-methyl-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 19871683 |
| Molecular Formula | C16H14F4O2 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-methyl-4-[2,3,5,6-tetrafluoro-4-(3-hydroxy-3-methylbut-1-ynyl)phenyl]but-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1c(F)c(F)c(C#CC(C)(C)O)c(F)c1F |
| InChI | InChI=1S/C16H14F4O2/c1-15(2,21)7-5-9-11(17)13(19)10(14(20)12(9)18)6-8-16(3,4)22/h21-22H,1-4H3 |
| InChIKey | NVADVQDHQSPUDC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|