C9H8O — CID 19876692
2-methoxybicyclo[2.2.2]octa-1,3,5,7-tetraene (PubChem CID 19876692) has the molecular formula C9H8O and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-methoxybicyclo[2.2.2]octa-1,3,5,7-tetraene.
| Compound Name | 2-methoxybicyclo[2.2.2]octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 19876692 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-methoxybicyclo[2.2.2]octa-1,3,5,7-tetraene |
| SMILES | COc1cc2ccc1cc2 |
| InChI | InChI=1S/C9H8O/c1-10-9-6-7-2-4-8(9)5-3-7/h2-6H,1H3 |
| InChIKey | BMYUGELAMBUQKF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |