C21H32N2O2 — CID 19880462
4-(2-cyclohexyl-1,3-dioxolan-2-yl)butanenitrile;N,N-dimethylaniline (PubChem CID 19880462) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 4-(2-cyclohexyl-1,3-dioxolan-2-yl)butanenitrile;N,N-dimethylaniline.
| Compound Name | 4-(2-cyclohexyl-1,3-dioxolan-2-yl)butanenitrile;N,N-dimethylaniline |
|---|---|
| PubChem CID | 19880462 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 4-(2-cyclohexyl-1,3-dioxolan-2-yl)butanenitrile;N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1.N#CCCCC1(C2CCCCC2)OCCO1 |
| InChI | InChI=1S/C13H21NO2.C8H11N/c14-9-5-4-8-13(15-10-11-16-13)12-6-2-1-3-7-12;1-9(2)8-6-4-3-5-7-8/h12H,1-8,10-11H2;3-7H,1-2H3 |
| InChIKey | FRRIWVHJZKPKMC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|