C9H15F3OSi — CID 19922166
2-ethenyl-2-(3,3,3-trifluoropropyl)oxasilinane (PubChem CID 19922166) has the molecular formula C9H15F3OSi and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-ethenyl-2-(3,3,3-trifluoropropyl)oxasilinane.
| Compound Name | 2-ethenyl-2-(3,3,3-trifluoropropyl)oxasilinane |
|---|---|
| PubChem CID | 19922166 |
| Molecular Formula | C9H15F3OSi |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-ethenyl-2-(3,3,3-trifluoropropyl)oxasilinane |
| SMILES | C=C[Si]1(CCC(F)(F)F)CCCCO1 |
| InChI | InChI=1S/C9H15F3OSi/c1-2-14(7-4-3-6-13-14)8-5-9(10,11)12/h2H,1,3-8H2 |
| InChIKey | ONUZAVXMVXNKBL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|