C23H28N4O6S — CID 19970523
5-N-[4-(cyclohexanecarbonylamino)phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide (PubChem CID 19970523) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is 5-N-[4-(cyclohexanecarbonylamino)phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[4-(cyclohexanecarbonylamino)phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970523 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 5-N-[4-(cyclohexanecarbonylamino)phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide |
| SMILES | COCCNC(=O)c1ccc(C(=O)NS(=O)(=O)c2ccc(NC(=O)C3CCCCC3)cc2)cn1 |
| InChI | InChI=1S/C23H28N4O6S/c1-33-14-13-24-23(30)20-12-7-17(15-25-20)22(29)27-34(31,32)19-10-8-18(9-11-19)26-21(28)16-5-3-2-4-6-16/h7-12,15-16H,2-6,13-14H2,1H3,(H,24,30)(H,26,28)(H,27,29) |
| InChIKey | WXHDWLJGSDYGOF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|