C32H34N4O5 — CID 19975176
benzyl 4-[5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoyl]piperazine-1-carboxylate (PubChem CID 19975176) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is benzyl 4-[5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19975176 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | benzyl 4-[5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoyl]piperazine-1-carboxylate |
| SMILES | O=C(CCCCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)N1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H34N4O5/c37-28(34-20-22-35(23-21-34)31(40)41-24-25-12-4-1-5-13-25)18-10-11-19-36-29(38)32(33-30(36)39,26-14-6-2-7-15-26)27-16-8-3-9-17-27/h1-9,12-17H,10-11,18-24H2,(H,33,39) |
| InChIKey | OXZSVNMAOOMREC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|