C21H20N2O3S2 — CID 2014729
(2Z)-2-(benzenesulfonyl)-2-[3-(4-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetonitrile (PubChem CID 2014729) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is (2Z)-2-(benzenesulfonyl)-2-[3-(4-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetonitrile.
| Compound Name | (2Z)-2-(benzenesulfonyl)-2-[3-(4-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 2014729 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (2Z)-2-(benzenesulfonyl)-2-[3-(4-butylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]acetonitrile |
| SMILES | CCCCc1ccc(N2C(=O)CS/C2=C(/C#N)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O3S2/c1-2-3-7-16-10-12-17(13-11-16)23-20(24)15-27-21(23)19(14-22)28(25,26)18-8-5-4-6-9-18/h4-6,8-13H,2-3,7,15H2,1H3/b21-19- |
| InChIKey | GHGFOUGDUZVPFL-VZCXRCSSSA-N |
| XLogP | 4.28 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|