C11H9NS — CID 20502086
4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-imine (PubChem CID 20502086) has the molecular formula C11H9NS and a molecular weight of 187.27 g/mol. Its IUPAC name is 4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-imine.
| Compound Name | 4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 20502086 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 4-thiopyran-2-ylidenecyclohexa-2,5-dien-1-imine |
| SMILES | [H]N=C1C=CC(=C2C=CC=CS2)C=C1 |
| InChI | InChI=1S/C11H9NS/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11/h1-8,12H/b11-9-,12-10+ |
| InChIKey | NRJGMNNOWCEODK-DSOJMZEYSA-N |
| XLogP | 3.20 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|