C10H9NOS — CID 20504202
2-phenyl-3H-1,2-thiazole-4-carbaldehyde (PubChem CID 20504202) has the molecular formula C10H9NOS and a molecular weight of 191.26 g/mol. Its IUPAC name is 2-phenyl-3H-1,2-thiazole-4-carbaldehyde.
| Compound Name | 2-phenyl-3H-1,2-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 20504202 |
| Molecular Formula | C10H9NOS |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 2-phenyl-3H-1,2-thiazole-4-carbaldehyde |
| SMILES | O=CC1=CSN(c2ccccc2)C1 |
| InChI | InChI=1S/C10H9NOS/c12-7-9-6-11(13-8-9)10-4-2-1-3-5-10/h1-5,7-8H,6H2 |
| InChIKey | IISSIMYRIBOOFQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|