C31H58N2O4 — CID 20512097
bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2,2-diethylpropanedioate (PubChem CID 20512097) has the molecular formula C31H58N2O4 and a molecular weight of 522.82 g/mol. Its IUPAC name is bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2,2-diethylpropanedioate.
| Compound Name | bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 20512097 |
| Molecular Formula | C31H58N2O4 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.44 |
| IUPAC Name | bis(2,6-diethyl-2,3,6-trimethylpiperidin-4-yl) 2,2-diethylpropanedioate |
| SMILES | CCC1(C)CC(OC(=O)C(CC)(CC)C(=O)OC2CC(C)(CC)NC(C)(CC)C2C)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C31H58N2O4/c1-13-27(9)19-23(21(7)29(11,15-3)32-27)36-25(34)31(17-5,18-6)26(35)37-24-20-28(10,14-2)33-30(12,16-4)22(24)8/h21-24,32-33H,13-20H2,1-12H3 |
| InChIKey | ZVFIILGXJVXSJV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|