C27H50N2O4 — CID 20512114
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-diethylpropanedioate (PubChem CID 20512114) has the molecular formula C27H50N2O4 and a molecular weight of 466.71 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-diethylpropanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 20512114 |
| Molecular Formula | C27H50N2O4 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2,2-diethylpropanedioate |
| SMILES | CCC(CC)(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C27H50N2O4/c1-13-27(14-2,21(30)32-19-15-23(3,4)28(11)24(5,6)16-19)22(31)33-20-17-25(7,8)29(12)26(9,10)18-20/h19-20H,13-18H2,1-12H3 |
| InChIKey | RLVKZFOXSWDGCL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|