C16H30NO+ — CID 2054608
(2R)-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-2-yl]-1,3-oxazolidin-3-ium (PubChem CID 2054608) has the molecular formula C16H30NO+ and a molecular weight of 252.42 g/mol. Its IUPAC name is (2R)-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-2-yl]-1,3-oxazolidin-3-ium.
| Compound Name | (2R)-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-2-yl]-1,3-oxazolidin-3-ium |
|---|---|
| PubChem CID | 2054608 |
| Molecular Formula | C16H30NO+ |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (2R)-2-[(4E)-2,5,9-trimethyldeca-4,8-dien-2-yl]-1,3-oxazolidin-3-ium |
| SMILES | CC(C)=CCC/C(C)=C/CC(C)(C)[C@@H]1[NH2+]CCO1 |
| InChI | InChI=1S/C16H29NO/c1-13(2)7-6-8-14(3)9-10-16(4,5)15-17-11-12-18-15/h7,9,15,17H,6,8,10-12H2,1-5H3/p+1/b14-9+/t15-/m1/s1 |
| InChIKey | IUSIHBDWTHQPIA-AAWPKVBNSA-O |
| XLogP | 3.02 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|