C16H20O8-2 — CID 20563785
2,2-bis(2-prop-2-enoyloxyethyl)hexanedioate (PubChem CID 20563785) has the molecular formula C16H20O8-2 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2,2-bis(2-prop-2-enoyloxyethyl)hexanedioate.
| Compound Name | 2,2-bis(2-prop-2-enoyloxyethyl)hexanedioate |
|---|---|
| PubChem CID | 20563785 |
| Molecular Formula | C16H20O8-2 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2,2-bis(2-prop-2-enoyloxyethyl)hexanedioate |
| SMILES | C=CC(=O)OCCC(CCCC(=O)[O-])(CCOC(=O)C=C)C(=O)[O-] |
| InChI | InChI=1S/C16H22O8/c1-3-13(19)23-10-8-16(15(21)22,7-5-6-12(17)18)9-11-24-14(20)4-2/h3-4H,1-2,5-11H2,(H,17,18)(H,21,22)/p-2 |
| InChIKey | LRBBAVBIBJXCRK-UHFFFAOYSA-L |
| XLogP | -1.12 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|