C33H49S2+ — CID 20575500
2,6-ditert-butyl-4-[(1E,3Z)-5-(2,6-ditert-butylthiopyran-4-ylidene)-3-ethylpenta-1,3-dienyl]thiopyrylium (PubChem CID 20575500) has the molecular formula C33H49S2+ and a molecular weight of 509.89 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(1E,3Z)-5-(2,6-ditert-butylthiopyran-4-ylidene)-3-ethylpenta-1,3-dienyl]thiopyrylium.
| Compound Name | 2,6-ditert-butyl-4-[(1E,3Z)-5-(2,6-ditert-butylthiopyran-4-ylidene)-3-ethylpenta-1,3-dienyl]thiopyrylium |
|---|---|
| PubChem CID | 20575500 |
| Molecular Formula | C33H49S2+ |
| Molecular Weight | 509.89 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 2,6-ditert-butyl-4-[(1E,3Z)-5-(2,6-ditert-butylthiopyran-4-ylidene)-3-ethylpenta-1,3-dienyl]thiopyrylium |
| SMILES | CCC(=C/C=C1C=C(C(C)(C)C)SC(C(C)(C)C)=C1)/C=C/c1cc(C(C)(C)C)[s+]c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H49S2/c1-14-23(15-17-24-19-26(30(2,3)4)34-27(20-24)31(5,6)7)16-18-25-21-28(32(8,9)10)35-29(22-25)33(11,12)13/h15-22H,14H2,1-13H3/q+1 |
| InChIKey | XRHHLNGPKXVXBQ-UHFFFAOYSA-N |
| XLogP | 11.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.89 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|