C22H32O4 — CID 20608184
[(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxan-3-yl)methyl] acetate (PubChem CID 20608184) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxan-3-yl)methyl] acetate.
| Compound Name | [(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxan-3-yl)methyl] acetate |
|---|---|
| PubChem CID | 20608184 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-(2-oxooxan-3-yl)methyl] acetate |
| SMILES | CC(=O)OC(C1CCCOC1=O)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C22H32O4/c1-10-11(2)16-9-15(10)19-13-7-17(20(16)19)18(8-13)21(26-12(3)23)14-5-4-6-25-22(14)24/h10-11,13-21H,4-9H2,1-3H3 |
| InChIKey | YVDWJQYMUIPBAY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|