C21H14F4O2 — CID 20621895
(2,3-difluoro-4-methylphenyl) 4-(2,3-difluoro-4-methylphenyl)benzoate (PubChem CID 20621895) has the molecular formula C21H14F4O2 and a molecular weight of 374.33 g/mol. Its IUPAC name is (2,3-difluoro-4-methylphenyl) 4-(2,3-difluoro-4-methylphenyl)benzoate.
| Compound Name | (2,3-difluoro-4-methylphenyl) 4-(2,3-difluoro-4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 20621895 |
| Molecular Formula | C21H14F4O2 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | (2,3-difluoro-4-methylphenyl) 4-(2,3-difluoro-4-methylphenyl)benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(-c3ccc(C)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C21H14F4O2/c1-11-3-9-15(19(24)17(11)22)13-5-7-14(8-6-13)21(26)27-16-10-4-12(2)18(23)20(16)25/h3-10H,1-2H3 |
| InChIKey | RDBDRXOEBIZWJW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|