C9H8F12 — CID 20633699
3-ethyl-1,1,1,4,4,5-hexafluoro-2,3-bis(trifluoromethyl)pentane (PubChem CID 20633699) has the molecular formula C9H8F12 and a molecular weight of 344.14 g/mol. Its IUPAC name is 3-ethyl-1,1,1,4,4,5-hexafluoro-2,3-bis(trifluoromethyl)pentane.
| Compound Name | 3-ethyl-1,1,1,4,4,5-hexafluoro-2,3-bis(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 20633699 |
| Molecular Formula | C9H8F12 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3-ethyl-1,1,1,4,4,5-hexafluoro-2,3-bis(trifluoromethyl)pentane |
| SMILES | CCC(C(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)CF |
| InChI | InChI=1S/C9H8F12/c1-2-5(9(19,20)21,6(11,12)3-10)4(7(13,14)15)8(16,17)18/h4H,2-3H2,1H3 |
| InChIKey | WNUAFPYDKYLYAL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |