C8H8N4O6S2 — CID 20644092
2-[5-[[5-(2-hydroperoxyethyl)-1,3,4-oxadiazol-2-yl]disulfanyl]-1,3,4-oxadiazol-2-yl]acetic acid (PubChem CID 20644092) has the molecular formula C8H8N4O6S2 and a molecular weight of 320.31 g/mol. Its IUPAC name is 2-[5-[[5-(2-hydroperoxyethyl)-1,3,4-oxadiazol-2-yl]disulfanyl]-1,3,4-oxadiazol-2-yl]acetic acid.
| Compound Name | 2-[5-[[5-(2-hydroperoxyethyl)-1,3,4-oxadiazol-2-yl]disulfanyl]-1,3,4-oxadiazol-2-yl]acetic acid |
|---|---|
| PubChem CID | 20644092 |
| Molecular Formula | C8H8N4O6S2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-[5-[[5-(2-hydroperoxyethyl)-1,3,4-oxadiazol-2-yl]disulfanyl]-1,3,4-oxadiazol-2-yl]acetic acid |
| SMILES | O=C(O)Cc1nnc(SSc2nnc(CCOO)o2)o1 |
| InChI | InChI=1S/C8H8N4O6S2/c13-6(14)3-5-10-12-8(18-5)20-19-7-11-9-4(17-7)1-2-16-15/h15H,1-3H2,(H,13,14) |
| InChIKey | TXAOQMORUMVZGG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|