C5H11N3U — CID 20644784
carbanide;1,4,5,6-tetrahydropyrimidin-2-ylazanide;uranium(2+) (PubChem CID 20644784) has the molecular formula C5H11N3U and a molecular weight of 351.19 g/mol. Its IUPAC name is carbanide;1,4,5,6-tetrahydropyrimidin-2-ylazanide;uranium(2+).
| Compound Name | carbanide;1,4,5,6-tetrahydropyrimidin-2-ylazanide;uranium(2+) |
|---|---|
| PubChem CID | 20644784 |
| Molecular Formula | C5H11N3U |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | carbanide;1,4,5,6-tetrahydropyrimidin-2-ylazanide;uranium(2+) |
| SMILES | [CH3-].[NH-]C1=NCCCN1.[U+2] |
| InChI | InChI=1S/C4H8N3.CH3.U/c5-4-6-2-1-3-7-4;;/h1-3H2,(H2-,5,6,7);1H3;/q2*-1;+2 |
| InChIKey | FMXQSLZFPAARAY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|