C14H20N2O5S — CID 20652161
[2-methyl-7-(2-sulfanylethylcarbamoyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate (PubChem CID 20652161) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is [2-methyl-7-(2-sulfanylethylcarbamoyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate.
| Compound Name | [2-methyl-7-(2-sulfanylethylcarbamoyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 20652161 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [2-methyl-7-(2-sulfanylethylcarbamoyl)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] N-methylcarbamate |
| SMILES | CNC(=O)OC1OC=C(C(=O)NCCS)C2CC3OC3(C)C12 |
| InChI | InChI=1S/C14H20N2O5S/c1-14-9(21-14)5-7-8(11(17)16-3-4-22)6-19-12(10(7)14)20-13(18)15-2/h6-7,9-10,12,22H,3-5H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | FCYTZACTLOJIIL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|