C15H26 — CID 20695232
(4E,8E)-4,5,7,7,8-pentamethyldeca-1,4,8-triene (PubChem CID 20695232) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is (4E,8E)-4,5,7,7,8-pentamethyldeca-1,4,8-triene.
| Compound Name | (4E,8E)-4,5,7,7,8-pentamethyldeca-1,4,8-triene |
|---|---|
| PubChem CID | 20695232 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | (4E,8E)-4,5,7,7,8-pentamethyldeca-1,4,8-triene |
| SMILES | C=CC/C(C)=C(\C)CC(C)(C)/C(C)=C/C |
| InChI | InChI=1S/C15H26/c1-8-10-12(3)13(4)11-15(6,7)14(5)9-2/h8-9H,1,10-11H2,2-7H3/b13-12+,14-9+ |
| InChIKey | DRBHLLJBXUPUFC-WIVVVKQNSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|