C17H30 — CID 59970603
4-ethylidene-5,5,6,6,7,8-hexamethylnona-1,7-diene (PubChem CID 59970603) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 4-ethylidene-5,5,6,6,7,8-hexamethylnona-1,7-diene.
| Compound Name | 4-ethylidene-5,5,6,6,7,8-hexamethylnona-1,7-diene |
|---|---|
| PubChem CID | 59970603 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 4-ethylidene-5,5,6,6,7,8-hexamethylnona-1,7-diene |
| SMILES | C=CCC(=CC)C(C)(C)C(C)(C)C(C)=C(C)C |
| InChI | InChI=1S/C17H30/c1-10-12-15(11-2)17(8,9)16(6,7)14(5)13(3)4/h10-11H,1,12H2,2-9H3 |
| InChIKey | CMCOZYCEIATLRR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|