C8H15N4O3+ — CID 20723680
diaminomethylidene-[3-(2,5-dioxomorpholin-3-yl)propyl]azanium (PubChem CID 20723680) has the molecular formula C8H15N4O3+ and a molecular weight of 215.23 g/mol. Its IUPAC name is diaminomethylidene-[3-(2,5-dioxomorpholin-3-yl)propyl]azanium.
| Compound Name | diaminomethylidene-[3-(2,5-dioxomorpholin-3-yl)propyl]azanium |
|---|---|
| PubChem CID | 20723680 |
| Molecular Formula | C8H15N4O3+ |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | diaminomethylidene-[3-(2,5-dioxomorpholin-3-yl)propyl]azanium |
| SMILES | NC(N)=[NH+]CCCC1NC(=O)COC1=O |
| InChI | InChI=1S/C8H14N4O3/c9-8(10)11-3-1-2-5-7(14)15-4-6(13)12-5/h5H,1-4H2,(H,12,13)(H4,9,10,11)/p+1 |
| InChIKey | WIFVXTWCULVXFH-UHFFFAOYSA-O |
| XLogP | -3.84 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|