C30H30N2O5 — CID 20746162
2-[3-[2-acetyloxyethyl(ethyl)azaniumylidene]-6-[ethenyl(ethyl)amino]xanthen-9-yl]benzoate (PubChem CID 20746162) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[3-[2-acetyloxyethyl(ethyl)azaniumylidene]-6-[ethenyl(ethyl)amino]xanthen-9-yl]benzoate.
| Compound Name | 2-[3-[2-acetyloxyethyl(ethyl)azaniumylidene]-6-[ethenyl(ethyl)amino]xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 20746162 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-[3-[2-acetyloxyethyl(ethyl)azaniumylidene]-6-[ethenyl(ethyl)amino]xanthen-9-yl]benzoate |
| SMILES | C=CN(CC)c1ccc2c(-c3ccccc3C(=O)[O-])c3cc/c(=[N+](/CC)CCOC(C)=O)cc-3oc2c1 |
| InChI | InChI=1S/C30H30N2O5/c1-5-31(6-2)21-12-14-25-27(18-21)37-28-19-22(32(7-3)16-17-36-20(4)33)13-15-26(28)29(25)23-10-8-9-11-24(23)30(34)35/h5,8-15,18-19H,1,6-7,16-17H2,2-4H3 |
| InChIKey | CBVHPTOPQRLLOH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|