C34H31N3O7S — CID 20780971
2-[[2-[4-[4-[[1-[(3-isocyanophenyl)sulfonylamino]cyclopentyl]methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid (PubChem CID 20780971) has the molecular formula C34H31N3O7S and a molecular weight of 625.70 g/mol. Its IUPAC name is 2-[[2-[4-[4-[[1-[(3-isocyanophenyl)sulfonylamino]cyclopentyl]methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[4-[[1-[(3-isocyanophenyl)sulfonylamino]cyclopentyl]methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 20780971 |
| Molecular Formula | C34H31N3O7S |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | 2-[[2-[4-[4-[[1-[(3-isocyanophenyl)sulfonylamino]cyclopentyl]methoxy]phenoxy]phenyl]acetyl]amino]benzoic acid |
| SMILES | [C-]#[N+]c1cccc(S(=O)(=O)NC2(COc3ccc(Oc4ccc(CC(=O)Nc5ccccc5C(=O)O)cc4)cc3)CCCC2)c1 |
| InChI | InChI=1S/C34H31N3O7S/c1-35-25-7-6-8-29(22-25)45(41,42)37-34(19-4-5-20-34)23-43-26-15-17-28(18-16-26)44-27-13-11-24(12-14-27)21-32(38)36-31-10-3-2-9-30(31)33(39)40/h2-3,6-18,22,37H,4-5,19-21,23H2,(H,36,38)(H,39,40) |
| InChIKey | BTQGQEQKDPICFB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 135.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|