C13H17N2O+ — CID 20783592
2-cyclohexyl-3H-4,1,2-benzoxadiazin-2-ium (PubChem CID 20783592) has the molecular formula C13H17N2O+ and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-cyclohexyl-3H-4,1,2-benzoxadiazin-2-ium.
| Compound Name | 2-cyclohexyl-3H-4,1,2-benzoxadiazin-2-ium |
|---|---|
| PubChem CID | 20783592 |
| Molecular Formula | C13H17N2O+ |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-cyclohexyl-3H-4,1,2-benzoxadiazin-2-ium |
| SMILES | c1ccc2c(c1)N=[N+](C1CCCCC1)CO2 |
| InChI | InChI=1S/C13H17N2O/c1-2-6-11(7-3-1)15-10-16-13-9-5-4-8-12(13)14-15/h4-5,8-9,11H,1-3,6-7,10H2/q+1 |
| InChIKey | DQVUWUDQXNJVOI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|